Quorumpeps Molecule

Quorumpeps®

GAKPCGGFF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID94
SMILESO=C(NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NCC(=O)NCC(=O)NC(C(=O)NC(C(=O)SC2)Cc3ccccc3)Cc4ccccc4)CCCCN)C)CN
Molecular formulaC41H56N10O9S
Chemical information
Species origin
Literature