Quorumpeps Molecule

Quorumpeps®

GANPCOLYY, thiolacton linkage between C5 and Y9

Quorumpeps moleculeID96
SMILESO=C(NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)Cc3ccc(O)cc3)Cc4ccc(O)cc4)CC(C)C)CCCN)CC(=O)N)C)CN
Molecular formulaC46H65N11O12S
Chemical information
Species origin
Literature