Quorumpeps Molecule

Quorumpeps®

QNSPNIFGQWM, lacton linkage between S3 and M11

Quorumpeps moleculeID97
SMILESO=C(N)CCC(N)C(=O)NC(C(=O)NC1C(=O)N5C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC1)CCSC)Cc3c2ccccc2nc3)CCC(=O)N)Cc4ccccc4)C(C)CC)CC(=O)N)CCC5)CC(=O)N
Molecular formulaC59H82N16O16S
Chemical information
Species origin
Functionality
Literature