Quorumpeps Molecule

Quorumpeps®

GGKVCSAYF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID98
SMILESO=C(NCC(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)C)CO)C(C)C)CCCCN)CN
Molecular formulaC42H60N10O11S
Chemical information
Species origin
Literature